Carboxylic acids and derivatives
Filtered Search Results
Ethyl tiglate, 98%
CAS: 5837-78-5 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00015183 InChI Key: OAPHLAAOJMTMLY-GQCTYLIASA-N Synonym: ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate PubChem CID: 5281163 ChEBI: CHEBI:4892 IUPAC Name: ethyl (E)-2-methylbut-2-enoate SMILES: CCOC(=O)C(=CC)C
| PubChem CID | 5281163 |
|---|---|
| CAS | 5837-78-5 |
| Molecular Weight (g/mol) | 128.171 |
| ChEBI | CHEBI:4892 |
| MDL Number | MFCD00015183 |
| SMILES | CCOC(=O)C(=CC)C |
| Synonym | ethyl tiglate,tiglic acid, ethyl ester,ethyl 2-methylcrotonate,ethyl alpha-methylcrotonate,ethyl trans-2-methyl-2-butenoate,e-2-methyl-2-butenoic acid ethyl ester,ethyl e-2-methylcrotonate,ethyl trans-2-methylcrotonate,tiglic acid ethyl ester,ethyl 2-methylbut-2-enoate |
| IUPAC Name | ethyl (E)-2-methylbut-2-enoate |
| InChI Key | OAPHLAAOJMTMLY-GQCTYLIASA-N |
| Molecular Formula | C7H12O2 |
Ethyl 2-butynoate, 98%
CAS: 4341-76-8 Molecular Formula: C6H8O2 Molecular Weight (g/mol): 112.128 MDL Number: MFCD00015182 InChI Key: FCJJZKCJURDYNF-UHFFFAOYSA-N Synonym: ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate PubChem CID: 78043 IUPAC Name: ethyl but-2-ynoate SMILES: CCOC(=O)C#CC
| PubChem CID | 78043 |
|---|---|
| CAS | 4341-76-8 |
| Molecular Weight (g/mol) | 112.128 |
| MDL Number | MFCD00015182 |
| SMILES | CCOC(=O)C#CC |
| Synonym | ethyl 2-butynoate,ethyl tetrolate,2-butynoic acid ethyl ester,but-2-ynoic acid ethyl ester,2-butynoic acid, ethyl ester,tetrolic acid ethyl ester,ethyl-2-butynoate,ethyl 3-methylpropiolate,acmc-1aeo2,ethyl 1-propynecarboxylate |
| IUPAC Name | ethyl but-2-ynoate |
| InChI Key | FCJJZKCJURDYNF-UHFFFAOYSA-N |
| Molecular Formula | C6H8O2 |
n-Butyl acetate, 99+%, Extra Dry, AcroSeal™
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Ethyl L(-)-lactate, 97%
CAS: 687-47-8 Molecular Formula: C5H10O3 Molecular Weight (g/mol): 118.13 MDL Number: MFCD00004518 InChI Key: LZCLXQDLBQLTDK-BYPYZUCNSA-N Synonym: ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s PubChem CID: 92831 ChEBI: CHEBI:78322 IUPAC Name: ethyl (2S)-2-hydroxypropanoate SMILES: CCOC(=O)C(C)O
| PubChem CID | 92831 |
|---|---|
| CAS | 687-47-8 |
| Molecular Weight (g/mol) | 118.13 |
| ChEBI | CHEBI:78322 |
| MDL Number | MFCD00004518 |
| SMILES | CCOC(=O)C(C)O |
| Synonym | ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s |
| IUPAC Name | ethyl (2S)-2-hydroxypropanoate |
| InChI Key | LZCLXQDLBQLTDK-BYPYZUCNSA-N |
| Molecular Formula | C5H10O3 |
Ethyl 2-methylbutyrate, 99%
CAS: 7452-79-1 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00012217 InChI Key: HCRBXQFHJMCTLF-UHFFFAOYSA-N Synonym: ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci PubChem CID: 24020 IUPAC Name: ethyl 2-methylbutanoate SMILES: CCC(C)C(=O)OCC
| PubChem CID | 24020 |
|---|---|
| CAS | 7452-79-1 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00012217 |
| SMILES | CCC(C)C(=O)OCC |
| Synonym | ethyl 2-methylbutyrate,butanoic acid, 2-methyl-, ethyl ester,butyric acid, 2-methyl-, ethyl ester,ethyl 2-methyl butyrate,ethyl alpha-methylbutyrate,dl-2-methylbutyric acid ethyl ester,ethyl 2-methyl-butanoate,ethyl .alpha.-methylbutyrate,2-methylbutanoic acid ethyl ester,butyric acid, 2-methyl-, ethyl ester 8ci |
| IUPAC Name | ethyl 2-methylbutanoate |
| InChI Key | HCRBXQFHJMCTLF-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Acetazolamide, 99%
CAS: 59-66-5 Molecular Formula: C4H6N4O3S2 Molecular Weight (g/mol): 222.24 MDL Number: MFCD00003105 InChI Key: BZKPWHYZMXOIDC-UHFFFAOYSA-N Synonym: acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran PubChem CID: 1986 ChEBI: CHEBI:27690 IUPAC Name: N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide SMILES: CC(=O)NC1=NN=C(S1)S(N)(=O)=O
| PubChem CID | 1986 |
|---|---|
| CAS | 59-66-5 |
| Molecular Weight (g/mol) | 222.24 |
| ChEBI | CHEBI:27690 |
| MDL Number | MFCD00003105 |
| SMILES | CC(=O)NC1=NN=C(S1)S(N)(=O)=O |
| Synonym | acetazolamide,diamox,acetazolamid,diacarb,glaupax,defiltran,nephramide,acetamox,cidamex,diluran |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChI Key | BZKPWHYZMXOIDC-UHFFFAOYSA-N |
| Molecular Formula | C4H6N4O3S2 |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one, 97%
CAS: 5381-99-7 Molecular Formula: C7H4ClO3P Molecular Weight (g/mol): 202.53 MDL Number: MFCD00013353 InChI Key: BVOITXUNGDUXRW-UHFFFAOYNA-N Synonym: 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent PubChem CID: 237010 IUPAC Name: 2-chloro-1,3,2-benzodioxaphosphinin-4-one SMILES: ClP1OC(=O)C2=CC=CC=C2O1
| PubChem CID | 237010 |
|---|---|
| CAS | 5381-99-7 |
| Molecular Weight (g/mol) | 202.53 |
| MDL Number | MFCD00013353 |
| SMILES | ClP1OC(=O)C2=CC=CC=C2O1 |
| Synonym | 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent |
| IUPAC Name | 2-chloro-1,3,2-benzodioxaphosphinin-4-one |
| InChI Key | BVOITXUNGDUXRW-UHFFFAOYNA-N |
| Molecular Formula | C7H4ClO3P |
Trimethylolpropane triacrylate, stabilized
CAS: 15625-89-5 Molecular Formula: C15H20O6 Molecular Weight (g/mol): 296.32 MDL Number: MFCD00008628 InChI Key: DAKWPKUUDNSNPN-UHFFFAOYSA-N Synonym: trimethylolpropane triacrylate,tmpta,viscoat 295,nk ester a tmpt,sartomer sr 351,ogumont t 200,saret 351,setalux uv 2241,ccris 92,unii-4b67kgl96s PubChem CID: 27423 ChEBI: CHEBI:35028 IUPAC Name: 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate SMILES: CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C
| PubChem CID | 27423 |
|---|---|
| CAS | 15625-89-5 |
| Molecular Weight (g/mol) | 296.32 |
| ChEBI | CHEBI:35028 |
| MDL Number | MFCD00008628 |
| SMILES | CCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| Synonym | trimethylolpropane triacrylate,tmpta,viscoat 295,nk ester a tmpt,sartomer sr 351,ogumont t 200,saret 351,setalux uv 2241,ccris 92,unii-4b67kgl96s |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate |
| InChI Key | DAKWPKUUDNSNPN-UHFFFAOYSA-N |
| Molecular Formula | C15H20O6 |
trans-Ethyl crotonate, 96%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |
2,2,3,3,3-Pentafluoropropyl methacrylate, 97%, stab.
CAS: 45115-53-5 Molecular Formula: C7H7F5O2 Molecular Weight (g/mol): 218.123 MDL Number: MFCD00039256 InChI Key: CLISWDZSTWQFNX-UHFFFAOYSA-N Synonym: 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor PubChem CID: 123516 IUPAC Name: 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(F)(F)F)(F)F
| PubChem CID | 123516 |
|---|---|
| CAS | 45115-53-5 |
| Molecular Weight (g/mol) | 218.123 |
| MDL Number | MFCD00039256 |
| SMILES | CC(=C)C(=O)OCC(C(F)(F)F)(F)F |
| Synonym | 1h,1h-pentafluoropropyl methacrylate,2,2,3,3,3-pentafluoropropyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,3-pentafluoropropyl ester,1h,1h-pentafluoro-n-propyl methacrylate,2,2,3,3,3-pentafluoro-n-propyl methacrylate,methacrylic acid 2,2,3,3,3-pentafluoropropyl ester,2,2,3,3,3-pentafluoropropyl methacrylate stabilized with tbc,2,2,3,3,3-pentafluoropropyl methacrylate, contains 100 ppm 4-tert-butylcatechol as inhibitor |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-methylprop-2-enoate |
| InChI Key | CLISWDZSTWQFNX-UHFFFAOYSA-N |
| Molecular Formula | C7H7F5O2 |
Tris(2-carboxyethyl)phosphine Hydrochloride 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxylatoethyl)phosphanyl]propanoate SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxylatoethyl)phosphanyl]propanoate |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Tin(II) oxalate
CAS: 814-94-8 Molecular Formula: C2O4Sn Molecular Weight (g/mol): 206.728 MDL Number: MFCD00040678 InChI Key: OQBLGYCUQGDOOR-UHFFFAOYSA-L Synonym: stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty PubChem CID: 13149 IUPAC Name: oxalate;tin(2+) SMILES: C(=O)(C(=O)[O-])[O-].[Sn+2]
| PubChem CID | 13149 |
|---|---|
| CAS | 814-94-8 |
| Molecular Weight (g/mol) | 206.728 |
| MDL Number | MFCD00040678 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Sn+2] |
| Synonym | stannous oxalate,tin ii oxalate,tin oxalate,tin 2+ oxalate,ethanedioic acid, tin 2+ salt 1:1,stavelan cinaty czech,unii-sar72fe8eh,sar72fe8eh,stavelan cinaty |
| IUPAC Name | oxalate;tin(2+) |
| InChI Key | OQBLGYCUQGDOOR-UHFFFAOYSA-L |
| Molecular Formula | C2O4Sn |
Calcium propionate, 98+%
CAS: 4075-81-4 Molecular Formula: C6H10CaO4 Molecular Weight (g/mol): 186.22 MDL Number: MFCD00167354 InChI Key: BCZXFFBUYPCTSJ-UHFFFAOYSA-L Synonym: calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 PubChem CID: 19999 ChEBI: CHEBI:81716 IUPAC Name: calcium;propanoate SMILES: [Ca++].CCC([O-])=O.CCC([O-])=O
| PubChem CID | 19999 |
|---|---|
| CAS | 4075-81-4 |
| Molecular Weight (g/mol) | 186.22 |
| ChEBI | CHEBI:81716 |
| MDL Number | MFCD00167354 |
| SMILES | [Ca++].CCC([O-])=O.CCC([O-])=O |
| Synonym | calcium propionate,calcium dipropionate,calcium propanoate,mycoban,propanoic acid, calcium salt,bioban-c,caswell no. 151,propionic acid, calcium salt,unii-8ai80040kw,hsdb 907 |
| IUPAC Name | calcium;propanoate |
| InChI Key | BCZXFFBUYPCTSJ-UHFFFAOYSA-L |
| Molecular Formula | C6H10CaO4 |
n-Butyl acetate, Semiconductor Grade, 99% min
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Dimethyl acetylenedicarboxylate, 95%
CAS: 762-42-5 Molecular Formula: C6H6O4 Molecular Weight (g/mol): 142.11 MDL Number: MFCD00008456 InChI Key: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonym: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene PubChem CID: 12980 IUPAC Name: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| PubChem CID | 12980 |
|---|---|
| CAS | 762-42-5 |
| Molecular Weight (g/mol) | 142.11 |
| MDL Number | MFCD00008456 |
| SMILES | COC(=O)C#CC(=O)OC |
| Synonym | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| IUPAC Name | dimethyl but-2-ynedioate |
| InChI Key | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O4 |